C8H7BrN6O5 — CID 135921231
1-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-nitroguanidine (PubChem CID 135921231) has the molecular formula C8H7BrN6O5 and a molecular weight of 347.09 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135921231 |
| Molecular Formula | C8H7BrN6O5 |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 1-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-nitroguanidine |
| SMILES | N/C(=N/[N+](=O)[O-])N/N=C/c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H7BrN6O5/c9-5-1-4(7(16)6(2-5)14(17)18)3-11-12-8(10)13-15(19)20/h1-3,16H,(H3,10,12,13)/b11-3+ |
| InChIKey | ASHHKPJTAJXNRS-QDEBKDIKSA-N |
| XLogP | 0.49 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|