C14H9Br2N3O5 — CID 136863460
5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 136863460) has the molecular formula C14H9Br2N3O5 and a molecular weight of 459.05 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 136863460 |
| Molecular Formula | C14H9Br2N3O5 |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 456.89 |
| IUPAC Name | 5-bromo-N-[(Z)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc([N+](=O)[O-])c1O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H9Br2N3O5/c15-8-1-2-12(20)10(4-8)14(22)18-17-6-7-3-9(16)5-11(13(7)21)19(23)24/h1-6,20-21H,(H,18,22)/b17-6- |
| InChIKey | YBCFVHWCVJFHSO-FMQZQXMHSA-N |
| XLogP | 3.29 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|