C14H8BrCl2N3O4 — CID 126224872
5-bromo-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 126224872) has the molecular formula C14H8BrCl2N3O4 and a molecular weight of 433.05 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126224872 |
| Molecular Formula | C14H8BrCl2N3O4 |
| Molecular Weight | 433.05 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | 5-bromo-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])c(Cl)cc1Cl)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H8BrCl2N3O4/c15-8-1-2-13(21)9(4-8)14(22)19-18-6-7-3-12(20(23)24)11(17)5-10(7)16/h1-6,21H,(H,19,22)/b18-6- |
| InChIKey | XFNIHSDGIYGJPF-FXBPXSCXSA-N |
| XLogP | 4.13 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|