C16H14BrN3O6 — CID 135614429
N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 135614429) has the molecular formula C16H14BrN3O6 and a molecular weight of 424.21 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 135614429 |
| Molecular Formula | C16H14BrN3O6 |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C/c2cc(Br)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C16H14BrN3O6/c1-25-12-4-9(5-13(7-12)26-2)16(22)19-18-8-10-3-11(17)6-14(15(10)21)20(23)24/h3-8,21H,1-2H3,(H,19,22)/b18-8+ |
| InChIKey | SYJWWJLBOZEITF-QGMBQPNBSA-N |
| XLogP | 2.84 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|