C8H8N6O5 — CID 135444892
1-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-nitroguanidine (PubChem CID 135444892) has the molecular formula C8H8N6O5 and a molecular weight of 268.19 g/mol. Its IUPAC name is 1-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135444892 |
| Molecular Formula | C8H8N6O5 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-nitroguanidine |
| SMILES | NC(=N[N+](=O)[O-])NN=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C8H8N6O5/c9-8(12-14(18)19)11-10-4-5-3-6(13(16)17)1-2-7(5)15/h1-4,15H,(H3,9,11,12) |
| InChIKey | UVRYLLBVQJLBMF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|