C9H10N4O4S — CID 5219276
[(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]thiourea (PubChem CID 5219276) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is [(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | [(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5219276 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | [(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]thiourea |
| SMILES | COc1cc(C=NNC(N)=S)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N4O4S/c1-17-6-2-5(4-11-12-9(10)18)8(14)7(3-6)13(15)16/h2-4,14H,1H3,(H3,10,12,18) |
| InChIKey | RGRYAXBUUWQEBC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|