C10H9N5O4 — CID 793810
4-methoxy-2-nitro-6-(1,2,4-triazol-4-yliminomethyl)phenol (PubChem CID 793810) has the molecular formula C10H9N5O4 and a molecular weight of 263.21 g/mol. Its IUPAC name is 4-methoxy-2-nitro-6-(1,2,4-triazol-4-yliminomethyl)phenol.
| Compound Name | 4-methoxy-2-nitro-6-(1,2,4-triazol-4-yliminomethyl)phenol |
|---|---|
| PubChem CID | 793810 |
| Molecular Formula | C10H9N5O4 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-methoxy-2-nitro-6-(1,2,4-triazol-4-yliminomethyl)phenol |
| SMILES | COc1cc(C=Nn2cnnc2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N5O4/c1-19-8-2-7(4-13-14-5-11-12-6-14)10(16)9(3-8)15(17)18/h2-6,16H,1H3 |
| InChIKey | JITLCJLLPHISDO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|