C9H6BrN5O3 — CID 135562926
4-bromo-2-nitro-6-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol (PubChem CID 135562926) has the molecular formula C9H6BrN5O3 and a molecular weight of 312.08 g/mol. Its IUPAC name is 4-bromo-2-nitro-6-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol.
| Compound Name | 4-bromo-2-nitro-6-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol |
|---|---|
| PubChem CID | 135562926 |
| Molecular Formula | C9H6BrN5O3 |
| Molecular Weight | 312.08 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 4-bromo-2-nitro-6-[(Z)-1,2,4-triazol-4-yliminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cc(Br)cc(/C=N\n2cnnc2)c1O |
| InChI | InChI=1S/C9H6BrN5O3/c10-7-1-6(3-13-14-4-11-12-5-14)9(16)8(2-7)15(17)18/h1-5,16H/b13-3- |
| InChIKey | IYCOKGGYJHMKKR-DXNYSGJVSA-N |
| XLogP | 1.54 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.08 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|