C10H9BrN4O2 — CID 796355
4-bromo-2-methoxy-6-(1,2,4-triazol-4-yliminomethyl)phenol (PubChem CID 796355) has the molecular formula C10H9BrN4O2 and a molecular weight of 297.11 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-(1,2,4-triazol-4-yliminomethyl)phenol.
| Compound Name | 4-bromo-2-methoxy-6-(1,2,4-triazol-4-yliminomethyl)phenol |
|---|---|
| PubChem CID | 796355 |
| Molecular Formula | C10H9BrN4O2 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 4-bromo-2-methoxy-6-(1,2,4-triazol-4-yliminomethyl)phenol |
| SMILES | COc1cc(Br)cc(C=Nn2cnnc2)c1O |
| InChI | InChI=1S/C10H9BrN4O2/c1-17-9-3-8(11)2-7(10(9)16)4-14-15-5-12-13-6-15/h2-6,16H,1H3 |
| InChIKey | AMQALRUESSNYKD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|