C16H16BrNO4 — CID 135592582
4-bromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol (PubChem CID 135592582) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is 4-bromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol.
| Compound Name | 4-bromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135592582 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-bromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1ccc(OC)c(/N=C/c2cc(Br)cc(OC)c2O)c1 |
| InChI | InChI=1S/C16H16BrNO4/c1-20-12-4-5-14(21-2)13(8-12)18-9-10-6-11(17)7-15(22-3)16(10)19/h4-9,19H,1-3H3/b18-9+ |
| InChIKey | MKSUVPLNLPNPGF-GIJQJNRQSA-N |
| XLogP | 3.93 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|