C15H12BrNO4 — CID 871301
2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]benzoic acid (PubChem CID 871301) has the molecular formula C15H12BrNO4 and a molecular weight of 350.17 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]benzoic acid.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 871301 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]benzoic acid |
| SMILES | COc1cc(Br)cc(/C=N/c2ccccc2C(=O)O)c1O |
| InChI | InChI=1S/C15H12BrNO4/c1-21-13-7-10(16)6-9(14(13)18)8-17-12-5-3-2-4-11(12)15(19)20/h2-8,18H,1H3,(H,19,20)/b17-8+ |
| InChIKey | ATRQOIVUGMLUNE-CAOOACKPSA-N |
| XLogP | 3.61 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|