C14H9BrN2O5 — CID 3302132
2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]benzoic acid (PubChem CID 3302132) has the molecular formula C14H9BrN2O5 and a molecular weight of 365.14 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]benzoic acid.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 3302132 |
| Molecular Formula | C14H9BrN2O5 |
| Molecular Weight | 365.14 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=C/c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H9BrN2O5/c15-9-5-8(13(18)12(6-9)17(21)22)7-16-11-4-2-1-3-10(11)14(19)20/h1-7,18H,(H,19,20)/b16-7+ |
| InChIKey | UFOLOUVNBLFJQU-FRKPEAEDSA-N |
| XLogP | 3.51 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.14 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|