C13H7Br3N2O4 — CID 3465048
3,5-dibromo-4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]phenol (PubChem CID 3465048) has the molecular formula C13H7Br3N2O4 and a molecular weight of 494.92 g/mol. Its IUPAC name is 3,5-dibromo-4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]phenol.
| Compound Name | 3,5-dibromo-4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 3465048 |
| Molecular Formula | C13H7Br3N2O4 |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 491.80 |
| IUPAC Name | 3,5-dibromo-4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]phenol |
| SMILES | O=[N+]([O-])c1cc(Br)cc(/C=N/c2c(Br)cc(O)cc2Br)c1O |
| InChI | InChI=1S/C13H7Br3N2O4/c14-7-1-6(13(20)11(2-7)18(21)22)5-17-12-9(15)3-8(19)4-10(12)16/h1-5,19-20H/b17-5+ |
| InChIKey | IEEIKGOMAVNBDL-YAXRCOADSA-N |
| XLogP | 5.04 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|