C21H25BrN2O3 — CID 136913238
4-bromo-2-[(2,5-ditert-butylphenyl)iminomethyl]-6-nitrophenol (PubChem CID 136913238) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 4-bromo-2-[(2,5-ditert-butylphenyl)iminomethyl]-6-nitrophenol.
| Compound Name | 4-bromo-2-[(2,5-ditert-butylphenyl)iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136913238 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-bromo-2-[(2,5-ditert-butylphenyl)iminomethyl]-6-nitrophenol |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(/N=C/c2cc(Br)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-20(2,3)14-7-8-16(21(4,5)6)17(10-14)23-12-13-9-15(22)11-18(19(13)25)24(26)27/h7-12,25H,1-6H3/b23-12+ |
| InChIKey | UYZUFGRSJMSNDM-FSJBWODESA-N |
| XLogP | 6.41 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|