C20H12BrN3O4 — CID 1039893
4-bromo-2-nitro-6-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenol (PubChem CID 1039893) has the molecular formula C20H12BrN3O4 and a molecular weight of 438.24 g/mol. Its IUPAC name is 4-bromo-2-nitro-6-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenol.
| Compound Name | 4-bromo-2-nitro-6-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 1039893 |
| Molecular Formula | C20H12BrN3O4 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 4-bromo-2-nitro-6-[(2-phenyl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cc(Br)cc(/C=N/c2ccc3oc(-c4ccccc4)nc3c2)c1O |
| InChI | InChI=1S/C20H12BrN3O4/c21-14-8-13(19(25)17(9-14)24(26)27)11-22-15-6-7-18-16(10-15)23-20(28-18)12-4-2-1-3-5-12/h1-11,25H/b22-11+ |
| InChIKey | UQYLFOJVIJEADU-SSDVNMTOSA-N |
| XLogP | 5.62 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|