C20H11Br3N2O3 — CID 2265686
2,4-dibromo-6-[[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]benzene-1,3-diol (PubChem CID 2265686) has the molecular formula C20H11Br3N2O3 and a molecular weight of 567.03 g/mol. Its IUPAC name is 2,4-dibromo-6-[[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 2,4-dibromo-6-[[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 2265686 |
| Molecular Formula | C20H11Br3N2O3 |
| Molecular Weight | 567.03 g/mol |
| Exact Mass | 563.83 |
| IUPAC Name | 2,4-dibromo-6-[[2-(3-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1c(Br)cc(/C=N/c2ccc3oc(-c4cccc(Br)c4)nc3c2)c(O)c1Br |
| InChI | InChI=1S/C20H11Br3N2O3/c21-12-3-1-2-10(6-12)20-25-15-8-13(4-5-16(15)28-20)24-9-11-7-14(22)19(27)17(23)18(11)26/h1-9,26-27H/b24-9+ |
| InChIKey | ICLFERJBNCGGPE-PGGKNCGUSA-N |
| XLogP | 6.94 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.03 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|