C19H12N4O4 — CID 171978560
2-nitro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol (PubChem CID 171978560) has the molecular formula C19H12N4O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-nitro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol.
| Compound Name | 2-nitro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 171978560 |
| Molecular Formula | C19H12N4O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-nitro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2ccc3oc(-c4cccnc4)nc3c2)c1O |
| InChI | InChI=1S/C19H12N4O4/c24-18-12(3-1-5-16(18)23(25)26)11-21-14-6-7-17-15(9-14)22-19(27-17)13-4-2-8-20-10-13/h1-11,24H/b21-11+ |
| InChIKey | JRVKROJOTULVCD-SRZZPIQSSA-N |
| XLogP | 4.25 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|