C21H14N3O5- — CID 7452517
2-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenolate (PubChem CID 7452517) has the molecular formula C21H14N3O5- and a molecular weight of 388.36 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenolate.
| Compound Name | 2-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7452517 |
| Molecular Formula | C21H14N3O5- |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenolate |
| SMILES | COc1ccc(-c2nc3cc(/N=C/c4cccc([N+](=O)[O-])c4[O-])ccc3o2)cc1 |
| InChI | InChI=1S/C21H15N3O5/c1-28-16-8-5-13(6-9-16)21-23-17-11-15(7-10-19(17)29-21)22-12-14-3-2-4-18(20(14)25)24(26)27/h2-12,25H,1H3/p-1/b22-12+ |
| InChIKey | UBLXKHSNMZWWCM-WSDLNYQXSA-M |
| XLogP | 4.24 |
| TPSA | 113.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|