C19H11Cl2N3O2 — CID 135721927
2,4-dichloro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol (PubChem CID 135721927) has the molecular formula C19H11Cl2N3O2 and a molecular weight of 384.22 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135721927 |
| Molecular Formula | C19H11Cl2N3O2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2,4-dichloro-6-[(2-pyridin-3-yl-1,3-benzoxazol-5-yl)iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1ccc2oc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C19H11Cl2N3O2/c20-13-6-12(18(25)15(21)7-13)10-23-14-3-4-17-16(8-14)24-19(26-17)11-2-1-5-22-9-11/h1-10,25H/b23-10+ |
| InChIKey | SNNFTVNOZZRTTN-AUEPDCJTSA-N |
| XLogP | 5.65 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|