C20H12Cl4N2O2 — CID 3279697
2,4-dichloro-6-[[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol (PubChem CID 3279697) has the molecular formula C20H12Cl4N2O2 and a molecular weight of 454.14 g/mol. Its IUPAC name is 2,4-dichloro-6-[[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3279697 |
| Molecular Formula | C20H12Cl4N2O2 |
| Molecular Weight | 454.14 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 2,4-dichloro-6-[[4-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1ccc(/N=C/c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C20H12Cl4N2O2/c21-13-5-11(19(27)17(23)7-13)9-25-15-1-2-16(4-3-15)26-10-12-6-14(22)8-18(24)20(12)28/h1-10,27-28H/b25-9+,26-10+ |
| InChIKey | BMTSCNZGECYDAW-ZZULHHKVSA-N |
| XLogP | 7.21 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.14 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|