C15H13Cl2NO2 — CID 590757
2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol (PubChem CID 590757) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 590757 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(/N=C/c2cc(Cl)cc(Cl)c2O)cc1C |
| InChI | InChI=1S/C15H13Cl2NO2/c1-8-3-13(14(19)4-9(8)2)18-7-10-5-11(16)6-12(17)15(10)20/h3-7,19-20H,1-2H3/b18-7+ |
| InChIKey | WAHDKGRUKZFKRW-CNHKJKLMSA-N |
| XLogP | 4.77 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|