C7H6Cl2N2O — CID 135445572
2,4-dichloro-6-[(E)-hydrazinylidenemethyl]phenol (PubChem CID 135445572) has the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-hydrazinylidenemethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-hydrazinylidenemethyl]phenol |
|---|---|
| PubChem CID | 135445572 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 2,4-dichloro-6-[(E)-hydrazinylidenemethyl]phenol |
| SMILES | N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C7H6Cl2N2O/c8-5-1-4(3-11-10)7(12)6(9)2-5/h1-3,12H,10H2/b11-3+ |
| InChIKey | MFGATNXEAQDBJY-QDEBKDIKSA-N |
| XLogP | 1.99 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|