C13H10Cl2N2OS — CID 143199865
2,4-dichloro-6-[(E)-[(4-sulfanylphenyl)hydrazinylidene]methyl]phenol (PubChem CID 143199865) has the molecular formula C13H10Cl2N2OS and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[(4-sulfanylphenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[(4-sulfanylphenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 143199865 |
| Molecular Formula | C13H10Cl2N2OS |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[(4-sulfanylphenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/Nc1ccc(S)cc1 |
| InChI | InChI=1S/C13H10Cl2N2OS/c14-9-5-8(13(18)12(15)6-9)7-16-17-10-1-3-11(19)4-2-10/h1-7,17-19H/b16-7+ |
| InChIKey | KABSSVZUIBDJKC-FRKPEAEDSA-N |
| XLogP | 4.43 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|