C12H10Cl2N4O2 — CID 136691682
2,4-dichloro-6-[[(3-methoxypyrazin-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136691682) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(3-methoxypyrazin-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(3-methoxypyrazin-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136691682 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2,4-dichloro-6-[[(3-methoxypyrazin-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1nccnc1NN=Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H10Cl2N4O2/c1-20-12-11(15-2-3-16-12)18-17-6-7-4-8(13)5-9(14)10(7)19/h2-6,19H,1H3,(H,15,18) |
| InChIKey | ASWOHQAESHQYSJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|