C17H16Cl2N2O4 — CID 2796783
2,4-dichloro-6-[[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]methyl]phenol (PubChem CID 2796783) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 2796783 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2,4-dichloro-6-[[(3,4,5-trimethoxyphenyl)methylidenehydrazinylidene]methyl]phenol |
| SMILES | COc1cc(C=NN=Cc2cc(Cl)cc(Cl)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-23-14-4-10(5-15(24-2)17(14)25-3)8-20-21-9-11-6-12(18)7-13(19)16(11)22/h4-9,22H,1-3H3 |
| InChIKey | OSZIWTPSBXKEKY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|