C9H11ClO4 — CID 13442752
6-chloro-2,3,4-trimethoxyphenol (PubChem CID 13442752) has the molecular formula C9H11ClO4 and a molecular weight of 218.64 g/mol. Its IUPAC name is 6-chloro-2,3,4-trimethoxyphenol.
| Compound Name | 6-chloro-2,3,4-trimethoxyphenol |
|---|---|
| PubChem CID | 13442752 |
| Molecular Formula | C9H11ClO4 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 6-chloro-2,3,4-trimethoxyphenol |
| SMILES | COc1cc(Cl)c(O)c(OC)c1OC |
| InChI | InChI=1S/C9H11ClO4/c1-12-6-4-5(10)7(11)9(14-3)8(6)13-2/h4,11H,1-3H3 |
| InChIKey | XBKIYVFHLPNALW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |