C14H19ClO5 — CID 117487561
3-(6-chloro-2,3,4-trimethoxyphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117487561) has the molecular formula C14H19ClO5 and a molecular weight of 302.75 g/mol. Its IUPAC name is 3-(6-chloro-2,3,4-trimethoxyphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(6-chloro-2,3,4-trimethoxyphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117487561 |
| Molecular Formula | C14H19ClO5 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-(6-chloro-2,3,4-trimethoxyphenyl)-2,2-dimethylpropanoic acid |
| SMILES | COc1cc(Cl)c(CC(C)(C)C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C14H19ClO5/c1-14(2,13(16)17)7-8-9(15)6-10(18-3)12(20-5)11(8)19-4/h6H,7H2,1-5H3,(H,16,17) |
| InChIKey | BIRLLXSJSQVGQQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |