C11H15ClO4 — CID 117369237
3-chloro-2-(2-hydroxypropyl)-5,6-dimethoxyphenol (PubChem CID 117369237) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is 3-chloro-2-(2-hydroxypropyl)-5,6-dimethoxyphenol.
| Compound Name | 3-chloro-2-(2-hydroxypropyl)-5,6-dimethoxyphenol |
|---|---|
| PubChem CID | 117369237 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-chloro-2-(2-hydroxypropyl)-5,6-dimethoxyphenol |
| SMILES | COc1cc(Cl)c(CC(C)O)c(O)c1OC |
| InChI | InChI=1S/C11H15ClO4/c1-6(13)4-7-8(12)5-9(15-2)11(16-3)10(7)14/h5-6,13-14H,4H2,1-3H3 |
| InChIKey | XFEDONCZTKWPHI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |