C11H14ClFO3 — CID 117374936
1-(3-chloro-2-fluoro-4,5-dimethoxyphenyl)propan-2-ol (PubChem CID 117374936) has the molecular formula C11H14ClFO3 and a molecular weight of 248.68 g/mol. Its IUPAC name is 1-(3-chloro-2-fluoro-4,5-dimethoxyphenyl)propan-2-ol.
| Compound Name | 1-(3-chloro-2-fluoro-4,5-dimethoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117374936 |
| Molecular Formula | C11H14ClFO3 |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-(3-chloro-2-fluoro-4,5-dimethoxyphenyl)propan-2-ol |
| SMILES | COc1cc(CC(C)O)c(F)c(Cl)c1OC |
| InChI | InChI=1S/C11H14ClFO3/c1-6(14)4-7-5-8(15-2)11(16-3)9(12)10(7)13/h5-6,14H,4H2,1-3H3 |
| InChIKey | AZVYPBFSSZBETL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |