C13H19ClO3 — CID 117400677
1-(6-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-ol (PubChem CID 117400677) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is 1-(6-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-ol.
| Compound Name | 1-(6-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117400677 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(6-chloro-2-ethyl-3,4-dimethoxyphenyl)propan-2-ol |
| SMILES | CCc1c(CC(C)O)c(Cl)cc(OC)c1OC |
| InChI | InChI=1S/C13H19ClO3/c1-5-9-10(6-8(2)15)11(14)7-12(16-3)13(9)17-4/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | TWMDNFCPCXTLAX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |