C12H16Cl2O4 — CID 101127363
1-(2,6-dichloro-3,4,5-trimethoxyphenyl)propan-2-ol (PubChem CID 101127363) has the molecular formula C12H16Cl2O4 and a molecular weight of 295.16 g/mol. Its IUPAC name is 1-(2,6-dichloro-3,4,5-trimethoxyphenyl)propan-2-ol.
| Compound Name | 1-(2,6-dichloro-3,4,5-trimethoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 101127363 |
| Molecular Formula | C12H16Cl2O4 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-(2,6-dichloro-3,4,5-trimethoxyphenyl)propan-2-ol |
| SMILES | COc1c(Cl)c(CC(C)O)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C12H16Cl2O4/c1-6(15)5-7-8(13)10(16-2)12(18-4)11(17-3)9(7)14/h6,15H,5H2,1-4H3 |
| InChIKey | HRAODPUUVKCMAG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |