C11H14Cl2O3 — CID 134197646
1,3-dichloro-2-ethyl-4,5,6-trimethoxybenzene (PubChem CID 134197646) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is 1,3-dichloro-2-ethyl-4,5,6-trimethoxybenzene.
| Compound Name | 1,3-dichloro-2-ethyl-4,5,6-trimethoxybenzene |
|---|---|
| PubChem CID | 134197646 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1,3-dichloro-2-ethyl-4,5,6-trimethoxybenzene |
| SMILES | CCc1c(Cl)c(OC)c(OC)c(OC)c1Cl |
| InChI | InChI=1S/C11H14Cl2O3/c1-5-6-7(12)9(14-2)11(16-4)10(15-3)8(6)13/h5H2,1-4H3 |
| InChIKey | PQGWQXNWZRRWLS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |