C13H14Cl2O5 — CID 154490646
2,5-dichloro-3-ethoxycarbonyl-4-ethyl-6-methoxybenzoic acid (PubChem CID 154490646) has the molecular formula C13H14Cl2O5 and a molecular weight of 321.16 g/mol. Its IUPAC name is 2,5-dichloro-3-ethoxycarbonyl-4-ethyl-6-methoxybenzoic acid.
| Compound Name | 2,5-dichloro-3-ethoxycarbonyl-4-ethyl-6-methoxybenzoic acid |
|---|---|
| PubChem CID | 154490646 |
| Molecular Formula | C13H14Cl2O5 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2,5-dichloro-3-ethoxycarbonyl-4-ethyl-6-methoxybenzoic acid |
| SMILES | CCOC(=O)c1c(Cl)c(C(=O)O)c(OC)c(Cl)c1CC |
| InChI | InChI=1S/C13H14Cl2O5/c1-4-6-7(13(18)20-5-2)10(15)8(12(16)17)11(19-3)9(6)14/h4-5H2,1-3H3,(H,16,17) |
| InChIKey | BBVYYLGXBDNJEZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |