C16H22O6 — CID 176550892
diethyl 2,5-diethyl-3,6-dihydroxybenzene-1,4-dicarboxylate (PubChem CID 176550892) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is diethyl 2,5-diethyl-3,6-dihydroxybenzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-diethyl-3,6-dihydroxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 176550892 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | diethyl 2,5-diethyl-3,6-dihydroxybenzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(O)c(CC)c(C(=O)OCC)c(O)c1CC |
| InChI | InChI=1S/C16H22O6/c1-5-9-11(15(19)21-7-3)14(18)10(6-2)12(13(9)17)16(20)22-8-4/h17-18H,5-8H2,1-4H3 |
| InChIKey | AJWQWAHCHQOMNE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|