C17H25ClO3 — CID 11162762
ethyl 3-butyl-5-(2-chloroethyl)-2-hydroxy-4,6-dimethylbenzoate (PubChem CID 11162762) has the molecular formula C17H25ClO3 and a molecular weight of 312.84 g/mol. Its IUPAC name is ethyl 3-butyl-5-(2-chloroethyl)-2-hydroxy-4,6-dimethylbenzoate.
| Compound Name | ethyl 3-butyl-5-(2-chloroethyl)-2-hydroxy-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 11162762 |
| Molecular Formula | C17H25ClO3 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethyl 3-butyl-5-(2-chloroethyl)-2-hydroxy-4,6-dimethylbenzoate |
| SMILES | CCCCc1c(C)c(CCCl)c(C)c(C(=O)OCC)c1O |
| InChI | InChI=1S/C17H25ClO3/c1-5-7-8-14-11(3)13(9-10-18)12(4)15(16(14)19)17(20)21-6-2/h19H,5-10H2,1-4H3 |
| InChIKey | LXBFGVMRLFSMII-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|