C19H28O5 — CID 143850417
dibutyl 5-hydroxy-2,4,6-trimethylbenzene-1,3-dicarboxylate (PubChem CID 143850417) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is dibutyl 5-hydroxy-2,4,6-trimethylbenzene-1,3-dicarboxylate.
| Compound Name | dibutyl 5-hydroxy-2,4,6-trimethylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 143850417 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | dibutyl 5-hydroxy-2,4,6-trimethylbenzene-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)c1c(C)c(O)c(C)c(C(=O)OCCCC)c1C |
| InChI | InChI=1S/C19H28O5/c1-6-8-10-23-18(21)15-12(3)16(14(5)17(20)13(15)4)19(22)24-11-9-7-2/h20H,6-11H2,1-5H3 |
| InChIKey | DEASNUVYCLETKY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|