C16H23NO5 — CID 56971607
dipropyl 5-amino-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate (PubChem CID 56971607) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is dipropyl 5-amino-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate.
| Compound Name | dipropyl 5-amino-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 56971607 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | dipropyl 5-amino-2-hydroxy-4,6-dimethylbenzene-1,3-dicarboxylate |
| SMILES | CCCOC(=O)c1c(C)c(N)c(C)c(C(=O)OCCC)c1O |
| InChI | InChI=1S/C16H23NO5/c1-5-7-21-15(19)11-9(3)13(17)10(4)12(14(11)18)16(20)22-8-6-2/h18H,5-8,17H2,1-4H3 |
| InChIKey | KBUMAJPSLNXSAB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|