C11H15NO4 — CID 84689679
methyl 5-amino-2-hydroxy-3-methoxy-4,6-dimethylbenzoate (PubChem CID 84689679) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl 5-amino-2-hydroxy-3-methoxy-4,6-dimethylbenzoate.
| Compound Name | methyl 5-amino-2-hydroxy-3-methoxy-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 84689679 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl 5-amino-2-hydroxy-3-methoxy-4,6-dimethylbenzoate |
| SMILES | COC(=O)c1c(C)c(N)c(C)c(OC)c1O |
| InChI | InChI=1S/C11H15NO4/c1-5-7(11(14)16-4)9(13)10(15-3)6(2)8(5)12/h13H,12H2,1-4H3 |
| InChIKey | YJDHDAVFQSALBW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|