C16H19I3O5 — CID 59638639
dibutyl 5-hydroxy-2,4,6-triiodobenzene-1,3-dicarboxylate (PubChem CID 59638639) has the molecular formula C16H19I3O5 and a molecular weight of 672.03 g/mol. Its IUPAC name is dibutyl 5-hydroxy-2,4,6-triiodobenzene-1,3-dicarboxylate.
| Compound Name | dibutyl 5-hydroxy-2,4,6-triiodobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59638639 |
| Molecular Formula | C16H19I3O5 |
| Molecular Weight | 672.03 g/mol |
| Exact Mass | 671.84 |
| IUPAC Name | dibutyl 5-hydroxy-2,4,6-triiodobenzene-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)c1c(I)c(O)c(I)c(C(=O)OCCCC)c1I |
| InChI | InChI=1S/C16H19I3O5/c1-3-5-7-23-15(21)9-11(17)10(13(19)14(20)12(9)18)16(22)24-8-6-4-2/h20H,3-8H2,1-2H3 |
| InChIKey | DGUOBKMTVIFFHA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.03 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|