C13H15I3O4 — CID 140500004
hexyl 2,3-dihydroxy-4,5,6-triiodobenzoate (PubChem CID 140500004) has the molecular formula C13H15I3O4 and a molecular weight of 615.97 g/mol. Its IUPAC name is hexyl 2,3-dihydroxy-4,5,6-triiodobenzoate.
| Compound Name | hexyl 2,3-dihydroxy-4,5,6-triiodobenzoate |
|---|---|
| PubChem CID | 140500004 |
| Molecular Formula | C13H15I3O4 |
| Molecular Weight | 615.97 g/mol |
| Exact Mass | 615.81 |
| IUPAC Name | hexyl 2,3-dihydroxy-4,5,6-triiodobenzoate |
| SMILES | CCCCCCOC(=O)c1c(O)c(O)c(I)c(I)c1I |
| InChI | InChI=1S/C13H15I3O4/c1-2-3-4-5-6-20-13(19)7-8(14)9(15)10(16)12(18)11(7)17/h17-18H,2-6H2,1H3 |
| InChIKey | SCLAUEZRVAVBMO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.97 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|