C44H71I3O4 — CID 10034051
bis[(Z)-octadec-9-enyl] 3,4,6-triiodobenzene-1,2-dicarboxylate (PubChem CID 10034051) has the molecular formula C44H71I3O4 and a molecular weight of 1044.76 g/mol. Its IUPAC name is bis[(Z)-octadec-9-enyl] 3,4,6-triiodobenzene-1,2-dicarboxylate.
| Compound Name | bis[(Z)-octadec-9-enyl] 3,4,6-triiodobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10034051 |
| Molecular Formula | C44H71I3O4 |
| Molecular Weight | 1044.76 g/mol |
| Exact Mass | 1044.25 |
| IUPAC Name | bis[(Z)-octadec-9-enyl] 3,4,6-triiodobenzene-1,2-dicarboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)c1c(I)cc(I)c(I)c1C(=O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H71I3O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-50-43(48)40-38(45)37-39(46)42(47)41(40)44(49)51-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37H,3-16,21-36H2,1-2H3/b19-17-,20-18- |
| InChIKey | JNWBOJQBFNFBBA-CLFAGFIQSA-N |
| XLogP | 15.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.76 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|