About bis[(E)-octadec-9-enyl] carbonate
bis[(E)-octadec-9-enyl] carbonate (PubChem CID 22342299) has the molecular formula C37H70O3
and a molecular weight of 562.96 g/mol. Its IUPAC name is bis[(E)-octadec-9-enyl] carbonate.
Molecular Properties
| Compound Name | bis[(E)-octadec-9-enyl] carbonate |
| PubChem CID | 22342299 |
| Molecular Formula | C37H70O3 |
| Molecular Weight | 562.96 g/mol |
| Exact Mass | 562.53 |
| IUPAC Name | bis[(E)-octadec-9-enyl] carbonate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOC(=O)OCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C37H70O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-37(38)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17+,20-18+ |
| InChIKey | RCEORVKQNSLBJN-XPWSMXQVSA-N |
| XLogP | 13.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.96 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(E)-octadec-9-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(E)-octadec-9-enyl] carbonate?
The IUPAC name of bis[(E)-octadec-9-enyl] carbonate (CID 22342299) is bis[(E)-octadec-9-enyl] carbonate.
What is the SMILES notation for bis[(E)-octadec-9-enyl] carbonate?
The canonical SMILES for bis[(E)-octadec-9-enyl] carbonate is CCCCCCCC/C=C/CCCCCCCCOC(=O)OCCCCCCCC/C=C/CCCCCCCC.
What is the InChIKey of bis[(E)-octadec-9-enyl] carbonate?
The InChIKey is RCEORVKQNSLBJN-XPWSMXQVSA-N. The full InChI is InChI=1S/C37H70O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-37(38)40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/b19-17+,20-18+.
What are the key properties of bis[(E)-octadec-9-enyl] carbonate?
bis[(E)-octadec-9-enyl] carbonate has a molecular weight of 562.96 g/mol, XLogP of 13.21, 32 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(E)-octadec-9-enyl] carbonate is sourced from PubChem (CID 22342299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).