C23H42O3 — CID 58356958
2-methylpropyl [(9Z,12E)-octadeca-9,12-dienyl] carbonate (PubChem CID 58356958) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is 2-methylpropyl [(9Z,12E)-octadeca-9,12-dienyl] carbonate.
| Compound Name | 2-methylpropyl [(9Z,12E)-octadeca-9,12-dienyl] carbonate |
|---|---|
| PubChem CID | 58356958 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 2-methylpropyl [(9Z,12E)-octadeca-9,12-dienyl] carbonate |
| SMILES | CCCCC/C=C/C/C=C\CCCCCCCCOC(=O)OCC(C)C |
| InChI | InChI=1S/C23H42O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-23(24)26-21-22(2)3/h8-9,11-12,22H,4-7,10,13-21H2,1-3H3/b9-8+,12-11- |
| InChIKey | DIMISEKSDCUBSU-UPDVNHGHSA-N |
| XLogP | 7.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|