C30H48O8 — CID 89033789
4-O-(2-methylpropoxycarbonyl) 1-O-[3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] butanedioate (PubChem CID 89033789) has the molecular formula C30H48O8 and a molecular weight of 536.71 g/mol. Its IUPAC name is 4-O-(2-methylpropoxycarbonyl) 1-O-[3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] butanedioate.
| Compound Name | 4-O-(2-methylpropoxycarbonyl) 1-O-[3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] butanedioate |
|---|---|
| PubChem CID | 89033789 |
| Molecular Formula | C30H48O8 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 4-O-(2-methylpropoxycarbonyl) 1-O-[3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropyl] butanedioate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OCCCOC(=O)CCC(=O)OC(=O)OCC(C)C |
| InChI | InChI=1S/C30H48O8/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-27(31)35-23-19-24-36-28(32)21-22-29(33)38-30(34)37-25-26(2)3/h8-9,11-12,14-15,26H,4-7,10,13,16-25H2,1-3H3/b9-8-,12-11-,15-14- |
| InChIKey | QOFCHNSBWUXQAM-ORZIMQNZSA-N |
| XLogP | 7.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|