C24H45NO2 — CID 87815188
[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-2-amino-4-methylpentanoate (PubChem CID 87815188) has the molecular formula C24H45NO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-2-amino-4-methylpentanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 87815188 |
| Molecular Formula | C24H45NO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 379.35 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-2-amino-4-methylpentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C24H45NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27-24(26)23(25)21-22(2)3/h8-9,11-12,22-23H,4-7,10,13-21,25H2,1-3H3/b9-8-,12-11-/t23-/m0/s1 |
| InChIKey | YKOVKBYAQFFLMS-VGKWPVBQSA-N |
| XLogP | 6.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|