About tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride
tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride (PubChem CID 154585621) has the molecular formula C20H42ClNO2
and a molecular weight of 364.01 g/mol. Its IUPAC name is tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride.
Molecular Properties
| Compound Name | tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| PubChem CID | 154585621 |
| Molecular Formula | C20H42ClNO2 |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| SMILES | CCCCCCCCCCCCCCOC(=O)[C@@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C20H41NO2.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-20(22)19(21)17-18(2)3;/h18-19H,4-17,21H2,1-3H3;1H/t19-;/m0./s1 |
| InChIKey | KAJWVVAKXQSZLW-FYZYNONXSA-N |
| XLogP | 6.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride?
The IUPAC name of tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CID 154585621) is tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride.
What is the SMILES notation for tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride?
The canonical SMILES for tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride is CCCCCCCCCCCCCCOC(=O)[C@@H](N)CC(C)C.Cl.
What is the InChIKey of tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride?
The InChIKey is KAJWVVAKXQSZLW-FYZYNONXSA-N. The full InChI is InChI=1S/C20H41NO2.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-20(22)19(21)17-18(2)3;/h18-19H,4-17,21H2,1-3H3;1H/t19-;/m0./s1.
What are the key properties of tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride?
tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride has a molecular weight of 364.01 g/mol, XLogP of 6.03, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl (2S)-2-amino-4-methylpentanoate;hydrochloride is sourced from PubChem (CID 154585621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).