About dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride
dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (PubChem CID 146680818) has the molecular formula C15H32ClNO3
and a molecular weight of 309.88 g/mol. Its IUPAC name is dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride.
Molecular Properties
| Compound Name | dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| PubChem CID | 146680818 |
| Molecular Formula | C15H32ClNO3 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| SMILES | CCCCCCCCCCCCOC(=O)[C@@H](N)CO.Cl |
| InChI | InChI=1S/C15H31NO3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-19-15(18)14(16)13-17;/h14,17H,2-13,16H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | NQUBRTLPPAGLMA-UQKRIMTDSA-N |
| XLogP | 3.19 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride?
The IUPAC name of dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CID 146680818) is dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride.
What is the SMILES notation for dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride?
The canonical SMILES for dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride is CCCCCCCCCCCCOC(=O)[C@@H](N)CO.Cl.
What is the InChIKey of dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride?
The InChIKey is NQUBRTLPPAGLMA-UQKRIMTDSA-N. The full InChI is InChI=1S/C15H31NO3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-19-15(18)14(16)13-17;/h14,17H,2-13,16H2,1H3;1H/t14-;/m0./s1.
What are the key properties of dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride?
dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride has a molecular weight of 309.88 g/mol, XLogP of 3.19, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride is sourced from PubChem (CID 146680818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).