About hexyl 2-amino-4-oxopentanoate
hexyl 2-amino-4-oxopentanoate (PubChem CID 87214543) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is hexyl 2-amino-4-oxopentanoate.
Molecular Properties
| Compound Name | hexyl 2-amino-4-oxopentanoate |
| PubChem CID | 87214543 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | hexyl 2-amino-4-oxopentanoate |
| SMILES | CCCCCCOC(=O)C(N)CC(C)=O |
| InChI | InChI=1S/C11H21NO3/c1-3-4-5-6-7-15-11(14)10(12)8-9(2)13/h10H,3-8,12H2,1-2H3 |
| InChIKey | BACMENZMTITADY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-amino-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-amino-4-oxopentanoate?
The IUPAC name of hexyl 2-amino-4-oxopentanoate (CID 87214543) is hexyl 2-amino-4-oxopentanoate.
What is the SMILES notation for hexyl 2-amino-4-oxopentanoate?
The canonical SMILES for hexyl 2-amino-4-oxopentanoate is CCCCCCOC(=O)C(N)CC(C)=O.
What is the InChIKey of hexyl 2-amino-4-oxopentanoate?
The InChIKey is BACMENZMTITADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-3-4-5-6-7-15-11(14)10(12)8-9(2)13/h10H,3-8,12H2,1-2H3.
What are the key properties of hexyl 2-amino-4-oxopentanoate?
hexyl 2-amino-4-oxopentanoate has a molecular weight of 215.29 g/mol, XLogP of 1.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-amino-4-oxopentanoate is sourced from PubChem (CID 87214543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).