C45H70O3 — CID 173337934
bis(docosa-7,10,13,16,19-pentaenyl) carbonate (PubChem CID 173337934) has the molecular formula C45H70O3 and a molecular weight of 659.05 g/mol. Its IUPAC name is bis(docosa-7,10,13,16,19-pentaenyl) carbonate.
| Compound Name | bis(docosa-7,10,13,16,19-pentaenyl) carbonate |
|---|---|
| PubChem CID | 173337934 |
| Molecular Formula | C45H70O3 |
| Molecular Weight | 659.05 g/mol |
| Exact Mass | 658.53 |
| IUPAC Name | bis(docosa-7,10,13,16,19-pentaenyl) carbonate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCCCOC(=O)OCCCCCCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C45H70O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-47-45(46)48-44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,29-32H,3-4,9-10,15-16,21-22,27-28,33-44H2,1-2H3 |
| InChIKey | NQLBKMPZLMLEQZ-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.05 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|