About ethanol;2-methylpropyl pentyl carbonate
ethanol;2-methylpropyl pentyl carbonate (PubChem CID 174542240) has the molecular formula C12H26O4
and a molecular weight of 234.34 g/mol. Its IUPAC name is ethanol;2-methylpropyl pentyl carbonate.
Molecular Properties
| Compound Name | ethanol;2-methylpropyl pentyl carbonate |
| PubChem CID | 174542240 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | ethanol;2-methylpropyl pentyl carbonate |
| SMILES | CCCCCOC(=O)OCC(C)C.CCO |
| InChI | InChI=1S/C10H20O3.C2H6O/c1-4-5-6-7-12-10(11)13-8-9(2)3;1-2-3/h9H,4-8H2,1-3H3;3H,2H2,1H3 |
| InChIKey | RNODLVJKRLPXPM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-methylpropyl pentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-methylpropyl pentyl carbonate?
The IUPAC name of ethanol;2-methylpropyl pentyl carbonate (CID 174542240) is ethanol;2-methylpropyl pentyl carbonate.
What is the SMILES notation for ethanol;2-methylpropyl pentyl carbonate?
The canonical SMILES for ethanol;2-methylpropyl pentyl carbonate is CCCCCOC(=O)OCC(C)C.CCO.
What is the InChIKey of ethanol;2-methylpropyl pentyl carbonate?
The InChIKey is RNODLVJKRLPXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3.C2H6O/c1-4-5-6-7-12-10(11)13-8-9(2)3;1-2-3/h9H,4-8H2,1-3H3;3H,2H2,1H3.
What are the key properties of ethanol;2-methylpropyl pentyl carbonate?
ethanol;2-methylpropyl pentyl carbonate has a molecular weight of 234.34 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-methylpropyl pentyl carbonate is sourced from PubChem (CID 174542240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).